C18H34N8O7 — CID 18244957
3-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-4-(carboxymethylamino)-4-oxobutanoic acid (PubChem CID 18244957) has the molecular formula C18H34N8O7 and a molecular weight of 474.52 g/mol. Its IUPAC name is 3-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-4-(carboxymethylamino)-4-oxobutanoic acid.
| Compound Name | 3-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-4-(carboxymethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18244957 |
| Molecular Formula | C18H34N8O7 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 3-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-4-(carboxymethylamino)-4-oxobutanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C18H34N8O7/c19-6-2-1-5-11(25-15(31)10(20)4-3-7-23-18(21)22)17(33)26-12(8-13(27)28)16(32)24-9-14(29)30/h10-12H,1-9,19-20H2,(H,24,32)(H,25,31)(H,26,33)(H,27,28)(H,29,30)(H4,21,22,23) |
| InChIKey | CVIMGTFQDBVFAJ-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|