C20H41N11O5 — CID 45279083
2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 45279083) has the molecular formula C20H41N11O5 and a molecular weight of 515.62 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 45279083 |
| Molecular Formula | C20H41N11O5 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.33 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C20H41N11O5/c21-8-2-1-6-14(30-16(34)12(22)5-3-9-27-19(23)24)18(36)31-13(7-4-10-28-20(25)26)17(35)29-11-15(32)33/h12-14H,1-11,21-22H2,(H,29,35)(H,30,34)(H,31,36)(H,32,33)(H4,23,24,27)(H4,25,26,28)/t12-,13-,14-/m0/s1 |
| InChIKey | KMJJLUNZTRBVQC-IHRRRGAJSA-N |
| XLogP | -4.28 |
| TPSA | 305.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|