C16H32N8O5 — CID 18302859
2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]acetic acid (PubChem CID 18302859) has the molecular formula C16H32N8O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 18302859 |
| Molecular Formula | C16H32N8O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]acetic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C16H32N8O5/c17-6-2-1-4-10(18)14(28)24-11(5-3-7-21-16(19)20)15(29)23-8-12(25)22-9-13(26)27/h10-11H,1-9,17-18H2,(H,22,25)(H,23,29)(H,24,28)(H,26,27)(H4,19,20,21) |
| InChIKey | HHRUJAUOWGGXJP-UHFFFAOYSA-N |
| XLogP | -3.70 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|