C17H34N8O5 — CID 18302852
2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]propanoic acid (PubChem CID 18302852) has the molecular formula C17H34N8O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18302852 |
| Molecular Formula | C17H34N8O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)CNC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C17H34N8O5/c1-10(16(29)30)24-13(26)9-23-15(28)12(6-4-8-22-17(20)21)25-14(27)11(19)5-2-3-7-18/h10-12H,2-9,18-19H2,1H3,(H,23,28)(H,24,26)(H,25,27)(H,29,30)(H4,20,21,22) |
| InChIKey | OJXOSFMAFPTVNH-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|