C25H46N10O9 — CID 88682933
5-(1-carboxyethylamino)-4-[2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]propanoylamino]-5-oxopentanoic acid (PubChem CID 88682933) has the molecular formula C25H46N10O9 and a molecular weight of 630.70 g/mol. Its IUPAC name is 5-(1-carboxyethylamino)-4-[2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]propanoylamino]-5-oxopentanoic acid.
| Compound Name | 5-(1-carboxyethylamino)-4-[2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]propanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 88682933 |
| Molecular Formula | C25H46N10O9 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | 5-(1-carboxyethylamino)-4-[2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]propanoylamino]-5-oxopentanoic acid |
| SMILES | CC(NC(=O)C(CCC(=O)O)NC(=O)C(C)NC(=O)CNC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C25H46N10O9/c1-13(20(39)34-17(8-9-19(37)38)23(42)33-14(2)24(43)44)32-18(36)12-31-22(41)16(7-5-11-30-25(28)29)35-21(40)15(27)6-3-4-10-26/h13-17H,3-12,26-27H2,1-2H3,(H,31,41)(H,32,36)(H,33,42)(H,34,39)(H,35,40)(H,37,38)(H,43,44)(H4,28,29,30) |
| InChIKey | KJYWLTAPPADERW-UHFFFAOYSA-N |
| XLogP | -4.46 |
| TPSA | 336.54 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|