C19H34N8O8 — CID 175711226
(4S)-4-amino-5-[[2-[[(2S)-1-[[(2S)-1-[[(1S)-1-carboxyethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid (PubChem CID 175711226) has the molecular formula C19H34N8O8 and a molecular weight of 502.53 g/mol. Its IUPAC name is (4S)-4-amino-5-[[2-[[(2S)-1-[[(2S)-1-[[(1S)-1-carboxyethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[[2-[[(2S)-1-[[(2S)-1-[[(1S)-1-carboxyethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175711226 |
| Molecular Formula | C19H34N8O8 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | (4S)-4-amino-5-[[2-[[(2S)-1-[[(2S)-1-[[(1S)-1-carboxyethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](C)NC(=O)CNC(=O)[C@@H](N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H34N8O8/c1-9(25-13(28)8-24-16(32)11(20)5-6-14(29)30)15(31)27-12(4-3-7-23-19(21)22)17(33)26-10(2)18(34)35/h9-12H,3-8,20H2,1-2H3,(H,24,32)(H,25,28)(H,26,33)(H,27,31)(H,29,30)(H,34,35)(H4,21,22,23)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | VWGKCOFNMBDHFF-BJDJZHNGSA-N |
| XLogP | -4.07 |
| TPSA | 281.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|