C23H38N8O5 — CID 18307477
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 18307477) has the molecular formula C23H38N8O5 and a molecular weight of 506.61 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18307477 |
| Molecular Formula | C23H38N8O5 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C23H38N8O5/c24-11-5-4-9-16(25)20(34)31-18(13-15-7-2-1-3-8-15)22(36)30-17(10-6-12-28-23(26)27)21(35)29-14-19(32)33/h1-3,7-8,16-18H,4-6,9-14,24-25H2,(H,29,35)(H,30,36)(H,31,34)(H,32,33)(H4,26,27,28) |
| InChIKey | YJDCRTMUFUJLKL-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|