C16H28N8O8 — CID 22652543
4-(carboxymethylamino)-3-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-4-oxobutanoic acid (PubChem CID 22652543) has the molecular formula C16H28N8O8 and a molecular weight of 460.45 g/mol. Its IUPAC name is 4-(carboxymethylamino)-3-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-(carboxymethylamino)-3-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22652543 |
| Molecular Formula | C16H28N8O8 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 4-(carboxymethylamino)-3-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C16H28N8O8/c17-7(4-10(18)25)13(30)23-8(2-1-3-21-16(19)20)15(32)24-9(5-11(26)27)14(31)22-6-12(28)29/h7-9H,1-6,17H2,(H2,18,25)(H,22,31)(H,23,30)(H,24,32)(H,26,27)(H,28,29)(H4,19,20,21) |
| InChIKey | YSXLOVOIZURJFL-UHFFFAOYSA-N |
| XLogP | -5.11 |
| TPSA | 295.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | -5.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|