C15H28N8O6 — CID 22652483
2-[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]propanoylamino]acetic acid (PubChem CID 22652483) has the molecular formula C15H28N8O6 and a molecular weight of 416.44 g/mol. Its IUPAC name is 2-[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]propanoylamino]acetic acid.
| Compound Name | 2-[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 22652483 |
| Molecular Formula | C15H28N8O6 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]propanoylamino]acetic acid |
| SMILES | CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(N)=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C15H28N8O6/c1-7(12(27)21-6-11(25)26)22-14(29)9(3-2-4-20-15(18)19)23-13(28)8(16)5-10(17)24/h7-9H,2-6,16H2,1H3,(H2,17,24)(H,21,27)(H,22,29)(H,23,28)(H,25,26)(H4,18,19,20) |
| InChIKey | ZTNHCODJXUKINA-UHFFFAOYSA-N |
| XLogP | -4.57 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -4.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|