C19H37N11O6 — CID 22652102
5-(diaminomethylideneamino)-2-[[5-(diaminomethylideneamino)-2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]pentanoyl]amino]pentanoic acid (PubChem CID 22652102) has the molecular formula C19H37N11O6 and a molecular weight of 515.58 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[5-(diaminomethylideneamino)-2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]pentanoyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[5-(diaminomethylideneamino)-2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]pentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 22652102 |
| Molecular Formula | C19H37N11O6 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[5-(diaminomethylideneamino)-2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]pentanoyl]amino]pentanoic acid |
| SMILES | CC(NC(=O)C(N)CC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H37N11O6/c1-9(28-15(33)10(20)8-13(21)31)14(32)29-11(4-2-6-26-18(22)23)16(34)30-12(17(35)36)5-3-7-27-19(24)25/h9-12H,2-8,20H2,1H3,(H2,21,31)(H,28,33)(H,29,32)(H,30,34)(H,35,36)(H4,22,23,26)(H4,24,25,27) |
| InChIKey | DOYHRSQDUISOPJ-UHFFFAOYSA-N |
| XLogP | -5.14 |
| TPSA | 322.51 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | -5.14 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|