C14H26N8O6 — CID 18218989
4-amino-2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-4-oxobutanoic acid (PubChem CID 18218989) has the molecular formula C14H26N8O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is 4-amino-2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18218989 |
| Molecular Formula | C14H26N8O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 4-amino-2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C14H26N8O6/c15-6(4-9(16)23)11(25)21-7(2-1-3-20-14(18)19)12(26)22-8(13(27)28)5-10(17)24/h6-8H,1-5,15H2,(H2,16,23)(H2,17,24)(H,21,25)(H,22,26)(H,27,28)(H4,18,19,20) |
| InChIKey | XHFXZQHTLJVZBN-UHFFFAOYSA-N |
| XLogP | -4.83 |
| TPSA | 272.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | -4.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|