C16H32N8O5 — CID 145454021
(2S)-6-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]pentanoyl]amino]hexanoic acid (PubChem CID 145454021) has the molecular formula C16H32N8O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]pentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145454021 |
| Molecular Formula | C16H32N8O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]pentanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C16H32N8O5/c17-6-2-1-4-11(15(28)29)24-14(27)10(5-3-7-22-16(20)21)23-13(26)9(18)8-12(19)25/h9-11H,1-8,17-18H2,(H2,19,25)(H,23,26)(H,24,27)(H,28,29)(H4,20,21,22)/t9-,10-,11-/m0/s1 |
| InChIKey | DQTIWTULBGLJBL-DCAQKATOSA-N |
| XLogP | -3.57 |
| TPSA | 255.03 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|