C16H30N8O8 — CID 22652790
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 22652790) has the molecular formula C16H30N8O8 and a molecular weight of 462.46 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 22652790 |
| Molecular Formula | C16H30N8O8 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C16H30N8O8/c17-7(4-11(18)27)12(28)22-8(2-1-3-21-16(19)20)13(29)23-9(5-25)14(30)24-10(6-26)15(31)32/h7-10,25-26H,1-6,17H2,(H2,18,27)(H,22,28)(H,23,29)(H,24,30)(H,31,32)(H4,19,20,21) |
| InChIKey | KWHKZTVYUFRFML-UHFFFAOYSA-N |
| XLogP | -6.23 |
| TPSA | 298.57 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | -6.23 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|