C18H34N8O6 — CID 22652663
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-methylpentanoyl]amino]acetic acid (PubChem CID 22652663) has the molecular formula C18H34N8O6 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-methylpentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-methylpentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 22652663 |
| Molecular Formula | C18H34N8O6 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-methylpentanoyl]amino]acetic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(N)=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C18H34N8O6/c1-3-9(2)14(17(32)24-8-13(28)29)26-16(31)11(5-4-6-23-18(21)22)25-15(30)10(19)7-12(20)27/h9-11,14H,3-8,19H2,1-2H3,(H2,20,27)(H,24,32)(H,25,30)(H,26,31)(H,28,29)(H4,21,22,23) |
| InChIKey | APAIAXPMYKDYEW-UHFFFAOYSA-N |
| XLogP | -3.54 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|