C17H32N8O6 — CID 11270734
2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]acetic acid (PubChem CID 11270734) has the molecular formula C17H32N8O6 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 11270734 |
| Molecular Formula | C17H32N8O6 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]acetic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C17H32N8O6/c1-8(18)13(28)23-10(3)15(30)25-11(5-4-6-21-17(19)20)16(31)24-9(2)14(29)22-7-12(26)27/h8-11H,4-7,18H2,1-3H3,(H,22,29)(H,23,28)(H,24,31)(H,25,30)(H,26,27)(H4,19,20,21)/t8-,9-,10-,11-/m0/s1 |
| InChIKey | QLVHMQYPRXMOHT-NAKRPEOUSA-N |
| XLogP | -3.92 |
| TPSA | 244.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|