C17H33N7O5 — CID 71350438
2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]acetic acid (PubChem CID 71350438) has the molecular formula C17H33N7O5 and a molecular weight of 415.50 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 71350438 |
| Molecular Formula | C17H33N7O5 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](C)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C17H33N7O5/c1-9(2)7-12(15(28)22-8-13(25)26)24-16(29)11(23-14(27)10(3)18)5-4-6-21-17(19)20/h9-12H,4-8,18H2,1-3H3,(H,22,28)(H,23,27)(H,24,29)(H,25,26)(H4,19,20,21)/t10-,11-,12-/m0/s1 |
| InChIKey | FLOLBLXEMADFRY-SRVKXCTJSA-N |
| XLogP | -2.40 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|