C17H34N10O5 — CID 18240548
2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 18240548) has the molecular formula C17H34N10O5 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18240548 |
| Molecular Formula | C17H34N10O5 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C17H34N10O5/c1-9(26-14(31)10(18)4-2-6-23-16(19)20)13(30)27-11(5-3-7-24-17(21)22)15(32)25-8-12(28)29/h9-11H,2-8,18H2,1H3,(H,25,32)(H,26,31)(H,27,30)(H,28,29)(H4,19,20,23)(H4,21,22,24) |
| InChIKey | MXYQOCHVORUVFO-UHFFFAOYSA-N |
| XLogP | -4.39 |
| TPSA | 279.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|