C11H22N6O5 — CID 18223812
2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 18223812) has the molecular formula C11H22N6O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18223812 |
| Molecular Formula | C11H22N6O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)CO)C(=O)NCC(=O)O |
| InChI | InChI=1S/C11H22N6O5/c12-6(5-18)9(21)17-7(2-1-3-15-11(13)14)10(22)16-4-8(19)20/h6-7,18H,1-5,12H2,(H,16,22)(H,17,21)(H,19,20)(H4,13,14,15) |
| InChIKey | HQTKVSCNCDLXSX-UHFFFAOYSA-N |
| XLogP | -3.95 |
| TPSA | 206.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|