C16H29N7O7S — CID 18256508
4-[(2-amino-3-sulfanylpropanoyl)amino]-5-[[1-(carboxymethylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18256508) has the molecular formula C16H29N7O7S and a molecular weight of 463.52 g/mol. Its IUPAC name is 4-[(2-amino-3-sulfanylpropanoyl)amino]-5-[[1-(carboxymethylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[(2-amino-3-sulfanylpropanoyl)amino]-5-[[1-(carboxymethylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18256508 |
| Molecular Formula | C16H29N7O7S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 4-[(2-amino-3-sulfanylpropanoyl)amino]-5-[[1-(carboxymethylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(N)CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C16H29N7O7S/c17-8(7-31)13(28)22-10(3-4-11(24)25)15(30)23-9(2-1-5-20-16(18)19)14(29)21-6-12(26)27/h8-10,31H,1-7,17H2,(H,21,29)(H,22,28)(H,23,30)(H,24,25)(H,26,27)(H4,18,19,20) |
| InChIKey | UUWRKRNDUYDDCA-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|