C27H46N10O5 — CID 18241128
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18241128) has the molecular formula C27H46N10O5 and a molecular weight of 590.73 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18241128 |
| Molecular Formula | C27H46N10O5 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H46N10O5/c1-16(2)14-20(24(40)37-21(25(41)42)15-17-8-4-3-5-9-17)36-23(39)19(11-7-13-34-27(31)32)35-22(38)18(28)10-6-12-33-26(29)30/h3-5,8-9,16,18-21H,6-7,10-15,28H2,1-2H3,(H,35,38)(H,36,39)(H,37,40)(H,41,42)(H4,29,30,33)(H4,31,32,34) |
| InChIKey | XNTRGLDNCNNCBL-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 279.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|