C24H39N7O5 — CID 18236584
2-[[2-[[2-(2-aminopropanoylamino)-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18236584) has the molecular formula C24H39N7O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18236584 |
| Molecular Formula | C24H39N7O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)CC(NC(=O)C(C)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H39N7O5/c1-14(2)12-18(30-20(32)15(3)25)22(34)29-17(10-7-11-28-24(26)27)21(33)31-19(23(35)36)13-16-8-5-4-6-9-16/h4-6,8-9,14-15,17-19H,7,10-13,25H2,1-3H3,(H,29,34)(H,30,32)(H,31,33)(H,35,36)(H4,26,27,28) |
| InChIKey | YBMRQYLLPZQECW-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|