C26H42N8O6 — CID 18482156
5-(diaminomethylideneamino)-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]pentanoic acid (PubChem CID 18482156) has the molecular formula C26H42N8O6 and a molecular weight of 562.67 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 18482156 |
| Molecular Formula | C26H42N8O6 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C26H42N8O6/c1-15(2)13-19(23(37)32-18(25(39)40)9-6-12-31-26(29)30)34-24(38)20(14-16-7-4-3-5-8-16)33-22(36)17(27)10-11-21(28)35/h3-5,7-8,15,17-20H,6,9-14,27H2,1-2H3,(H2,28,35)(H,32,37)(H,33,36)(H,34,38)(H,39,40)(H4,29,30,31) |
| InChIKey | SYTOHUCETIOMMG-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|