C25H35N7O5S — CID 175713685
(2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-naphthalen-2-ylpropanoyl]amino]propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 175713685) has the molecular formula C25H35N7O5S and a molecular weight of 545.67 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-naphthalen-2-ylpropanoyl]amino]propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-naphthalen-2-ylpropanoyl]amino]propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175713685 |
| Molecular Formula | C25H35N7O5S |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-naphthalen-2-ylpropanoyl]amino]propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](Cc1ccc2ccccc2c1)NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C25H35N7O5S/c1-14(21(33)32-20(13-38)24(36)37)30-23(35)19(31-22(34)18(26)7-4-10-29-25(27)28)12-15-8-9-16-5-2-3-6-17(16)11-15/h2-3,5-6,8-9,11,14,18-20,38H,4,7,10,12-13,26H2,1H3,(H,30,35)(H,31,34)(H,32,33)(H,36,37)(H4,27,28,29)/t14-,18-,19-,20-/m0/s1 |
| InChIKey | PZCWQPNCNXZHPW-DSYPUSFNSA-N |
| XLogP | -0.75 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|