C25H35N7O5 — CID 175747779
(2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]propanoic acid (PubChem CID 175747779) has the molecular formula C25H35N7O5 and a molecular weight of 513.60 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175747779 |
| Molecular Formula | C25H35N7O5 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1ccc2ccccc2c1)C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C25H35N7O5/c1-14(21(33)31-15(2)24(36)37)30-23(35)20(8-5-11-29-25(27)28)32-22(34)19(26)13-16-9-10-17-6-3-4-7-18(17)12-16/h3-4,6-7,9-10,12,14-15,19-20H,5,8,11,13,26H2,1-2H3,(H,30,35)(H,31,33)(H,32,34)(H,36,37)(H4,27,28,29)/t14-,15+,19-,20-/m0/s1 |
| InChIKey | ZPZOIWCVHFRDHT-VZJWBNGJSA-N |
| XLogP | -0.66 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|