C26H43N7O5 — CID 22651950
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid (PubChem CID 22651950) has the molecular formula C26H43N7O5 and a molecular weight of 533.67 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 22651950 |
| Molecular Formula | C26H43N7O5 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(NC(=O)C(N)CCCN=C(N)N)C(C)C)C(=O)O |
| InChI | InChI=1S/C26H43N7O5/c1-5-16(4)21(25(37)38)33-23(35)19(14-17-10-7-6-8-11-17)31-24(36)20(15(2)3)32-22(34)18(27)12-9-13-30-26(28)29/h6-8,10-11,15-16,18-21H,5,9,12-14,27H2,1-4H3,(H,31,36)(H,32,34)(H,33,35)(H,37,38)(H4,28,29,30) |
| InChIKey | NGOIPIZIHZYCQC-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|