C27H45N7O5 — CID 22703113
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid (PubChem CID 22703113) has the molecular formula C27H45N7O5 and a molecular weight of 547.70 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 22703113 |
| Molecular Formula | C27H45N7O5 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.35 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(C)C)C(=O)O |
| InChI | InChI=1S/C27H45N7O5/c1-5-17(4)22(26(38)39)34-25(37)21(15-18-10-7-6-8-11-18)33-24(36)20(12-9-13-31-27(29)30)32-23(35)19(28)14-16(2)3/h6-8,10-11,16-17,19-22H,5,9,12-15,28H2,1-4H3,(H,32,35)(H,33,36)(H,34,37)(H,38,39)(H4,29,30,31) |
| InChIKey | BVYVZNQPTQHPAS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|