C25H39N7O7 — CID 18247172
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid (PubChem CID 18247172) has the molecular formula C25H39N7O7 and a molecular weight of 549.63 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18247172 |
| Molecular Formula | C25H39N7O7 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H39N7O7/c1-3-14(2)20(24(38)39)32-23(37)18(12-15-8-5-4-6-9-15)31-22(36)17(10-7-11-29-25(27)28)30-21(35)16(26)13-19(33)34/h4-6,8-9,14,16-18,20H,3,7,10-13,26H2,1-2H3,(H,30,35)(H,31,36)(H,32,37)(H,33,34)(H,38,39)(H4,27,28,29) |
| InChIKey | LZBZMQJDPOQNCN-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|