C25H40N8O7 — CID 22652844
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoic acid (PubChem CID 22652844) has the molecular formula C25H40N8O7 and a molecular weight of 564.64 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 22652844 |
| Molecular Formula | C25H40N8O7 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C25H40N8O7/c1-3-13(2)20(24(39)40)33-23(38)18(11-14-6-8-15(34)9-7-14)32-22(37)17(5-4-10-30-25(28)29)31-21(36)16(26)12-19(27)35/h6-9,13,16-18,20,34H,3-5,10-12,26H2,1-2H3,(H2,27,35)(H,31,36)(H,32,37)(H,33,38)(H,39,40)(H4,28,29,30) |
| InChIKey | VHXORQOWMDAQOL-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|