C24H39N7O6 — CID 18239754
2-[[2-[[2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid (PubChem CID 18239754) has the molecular formula C24H39N7O6 and a molecular weight of 521.62 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18239754 |
| Molecular Formula | C24H39N7O6 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(C)N)C(=O)O |
| InChI | InChI=1S/C24H39N7O6/c1-4-13(2)19(23(36)37)31-21(34)17(6-5-11-28-24(26)27)29-22(35)18(30-20(33)14(3)25)12-15-7-9-16(32)10-8-15/h7-10,13-14,17-19,32H,4-6,11-12,25H2,1-3H3,(H,29,35)(H,30,33)(H,31,34)(H,36,37)(H4,26,27,28) |
| InChIKey | BBVQWQVAZXKTDR-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|