C27H45N7O6 — CID 22701842
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 22701842) has the molecular formula C27H45N7O6 and a molecular weight of 563.70 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 22701842 |
| Molecular Formula | C27H45N7O6 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.34 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)O)C(C)CC |
| InChI | InChI=1S/C27H45N7O6/c1-5-15(3)21(28)24(37)33-20(14-17-9-11-18(35)12-10-17)23(36)34-22(16(4)6-2)25(38)32-19(26(39)40)8-7-13-31-27(29)30/h9-12,15-16,19-22,35H,5-8,13-14,28H2,1-4H3,(H,32,38)(H,33,37)(H,34,36)(H,39,40)(H4,29,30,31) |
| InChIKey | SQTSGRCSXWNFMO-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|