C27H46N10O6 — CID 18241113
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18241113) has the molecular formula C27H46N10O6 and a molecular weight of 606.73 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18241113 |
| Molecular Formula | C27H46N10O6 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.36 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C27H46N10O6/c1-3-15(2)21(24(41)36-20(25(42)43)14-16-8-10-17(38)11-9-16)37-23(40)19(7-5-13-34-27(31)32)35-22(39)18(28)6-4-12-33-26(29)30/h8-11,15,18-21,38H,3-7,12-14,28H2,1-2H3,(H,35,39)(H,36,41)(H,37,40)(H,42,43)(H4,29,30,33)(H4,31,32,34) |
| InChIKey | BUSIMWNKUVDDFD-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 299.65 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|