C26H43N7O6S — CID 19997160
2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 19997160) has the molecular formula C26H43N7O6S and a molecular weight of 581.74 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 19997160 |
| Molecular Formula | C26H43N7O6S |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCSC)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C26H43N7O6S/c1-4-15(2)21(33-22(35)18(27)11-13-40-3)24(37)31-19(6-5-12-30-26(28)29)23(36)32-20(25(38)39)14-16-7-9-17(34)10-8-16/h7-10,15,18-21,34H,4-6,11-14,27H2,1-3H3,(H,31,37)(H,32,36)(H,33,35)(H,38,39)(H4,28,29,30) |
| InChIKey | ZLHPCOCZQJUEMI-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|