C26H41N7O8 — CID 22651470
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]pentanedioic acid (PubChem CID 22651470) has the molecular formula C26H41N7O8 and a molecular weight of 579.66 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22651470 |
| Molecular Formula | C26H41N7O8 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]pentanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H41N7O8/c1-3-14(2)21(24(39)31-18(25(40)41)10-11-20(35)36)33-23(38)19(13-15-6-8-16(34)9-7-15)32-22(37)17(27)5-4-12-30-26(28)29/h6-9,14,17-19,21,34H,3-5,10-13,27H2,1-2H3,(H,31,39)(H,32,37)(H,33,38)(H,35,36)(H,40,41)(H4,28,29,30) |
| InChIKey | YSTBUMPYCOBYKS-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 272.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|