C30H43N7O6 — CID 18501280
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18501280) has the molecular formula C30H43N7O6 and a molecular weight of 597.72 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18501280 |
| Molecular Formula | C30H43N7O6 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.33 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C30H43N7O6/c1-3-18(2)25(31)28(41)35-22(10-7-15-34-30(32)33)26(39)36-23(16-19-8-5-4-6-9-19)27(40)37-24(29(42)43)17-20-11-13-21(38)14-12-20/h4-6,8-9,11-14,18,22-25,38H,3,7,10,15-17,31H2,1-2H3,(H,35,41)(H,36,39)(H,37,40)(H,42,43)(H4,32,33,34) |
| InChIKey | OPMKURZSZLVVMM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|