C24H39N7O5S — CID 18296680
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18296680) has the molecular formula C24H39N7O5S and a molecular weight of 537.69 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18296680 |
| Molecular Formula | C24H39N7O5S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C24H39N7O5S/c1-3-14(2)19(25)22(34)30-17(12-15-8-5-4-6-9-15)20(32)31-18(13-37)21(33)29-16(23(35)36)10-7-11-28-24(26)27/h4-6,8-9,14,16-19,37H,3,7,10-13,25H2,1-2H3,(H,29,33)(H,30,34)(H,31,32)(H,35,36)(H4,26,27,28) |
| InChIKey | RUZRXNCWASIUCI-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|