C26H43N7O5S — CID 18296232
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18296232) has the molecular formula C26H43N7O5S and a molecular weight of 565.74 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18296232 |
| Molecular Formula | C26H43N7O5S |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCSC)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H43N7O5S/c1-4-16(2)21(27)24(36)32-19(12-14-39-3)23(35)31-18(11-8-13-30-26(28)29)22(34)33-20(25(37)38)15-17-9-6-5-7-10-17/h5-7,9-10,16,18-21H,4,8,11-15,27H2,1-3H3,(H,31,35)(H,32,36)(H,33,34)(H,37,38)(H4,28,29,30) |
| InChIKey | BIHLAFMJNGKOIR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|