C23H45N7O5S — CID 18501252
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-methylpentanoic acid (PubChem CID 18501252) has the molecular formula C23H45N7O5S and a molecular weight of 531.72 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18501252 |
| Molecular Formula | C23H45N7O5S |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCSC)C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C23H45N7O5S/c1-6-14(4)18(24)21(33)29-15(8-7-10-27-23(25)26)19(31)28-16(9-11-36-5)20(32)30-17(22(34)35)12-13(2)3/h13-18H,6-12,24H2,1-5H3,(H,28,31)(H,29,33)(H,30,32)(H,34,35)(H4,25,26,27) |
| InChIKey | VMZJGNKDGSCONB-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|