C18H36N6O4 — CID 102186789
(2S)-2-[[(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoic acid (PubChem CID 102186789) has the molecular formula C18H36N6O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 102186789 |
| Molecular Formula | C18H36N6O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C18H36N6O4/c1-5-11(4)14(19)16(26)23-12(7-6-8-22-18(20)21)15(25)24-13(17(27)28)9-10(2)3/h10-14H,5-9,19H2,1-4H3,(H,23,26)(H,24,25)(H,27,28)(H4,20,21,22)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | WECYRWOMWSCWNX-XUXIUFHCSA-N |
| XLogP | -0.49 |
| TPSA | 185.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|