C30H43N7O5 — CID 18501275
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18501275) has the molecular formula C30H43N7O5 and a molecular weight of 581.72 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18501275 |
| Molecular Formula | C30H43N7O5 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H43N7O5/c1-3-19(2)25(31)28(40)35-22(15-10-16-34-30(32)33)26(38)36-23(17-20-11-6-4-7-12-20)27(39)37-24(29(41)42)18-21-13-8-5-9-14-21/h4-9,11-14,19,22-25H,3,10,15-18,31H2,1-2H3,(H,35,40)(H,36,38)(H,37,39)(H,41,42)(H4,32,33,34) |
| InChIKey | GQBZKJQGOAYYHT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|