C25H41N7O6 — CID 18299858
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18299858) has the molecular formula C25H41N7O6 and a molecular weight of 535.65 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18299858 |
| Molecular Formula | C25H41N7O6 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)O)C(C)O |
| InChI | InChI=1S/C25H41N7O6/c1-14(2)12-17(26)21(34)31-19(13-16-8-5-4-6-9-16)22(35)32-20(15(3)33)23(36)30-18(24(37)38)10-7-11-29-25(27)28/h4-6,8-9,14-15,17-20,33H,7,10-13,26H2,1-3H3,(H,30,36)(H,31,34)(H,32,35)(H,37,38)(H4,27,28,29) |
| InChIKey | CTHRLEGIQGLWQC-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|