C24H38N8O6 — CID 22657643
5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]pentanoic acid (PubChem CID 22657643) has the molecular formula C24H38N8O6 and a molecular weight of 534.62 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 22657643 |
| Molecular Formula | C24H38N8O6 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]pentanoic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C24H38N8O6/c1-13(2)19(22(36)30-16(23(37)38)9-6-10-29-24(27)28)32-21(35)17(11-14-7-4-3-5-8-14)31-20(34)15(25)12-18(26)33/h3-5,7-8,13,15-17,19H,6,9-12,25H2,1-2H3,(H2,26,33)(H,30,36)(H,31,34)(H,32,35)(H,37,38)(H4,27,28,29) |
| InChIKey | NASDAGHENGCYBG-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|