C25H40N8O6 — CID 18484387
2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18484387) has the molecular formula C25H40N8O6 and a molecular weight of 548.65 g/mol. Its IUPAC name is 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18484387 |
| Molecular Formula | C25H40N8O6 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H40N8O6/c1-14(2)20(33-21(35)16(26)10-11-19(27)34)23(37)31-17(9-6-12-30-25(28)29)22(36)32-18(24(38)39)13-15-7-4-3-5-8-15/h3-5,7-8,14,16-18,20H,6,9-13,26H2,1-2H3,(H2,27,34)(H,31,37)(H,32,36)(H,33,35)(H,38,39)(H4,28,29,30) |
| InChIKey | XREBUSQJVZYIIM-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|