C25H39N7O7S — CID 18310753
4-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-[(1-carboxy-2-phenylethyl)amino]-5-oxopentanoic acid (PubChem CID 18310753) has the molecular formula C25H39N7O7S and a molecular weight of 581.70 g/mol. Its IUPAC name is 4-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-[(1-carboxy-2-phenylethyl)amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-[(1-carboxy-2-phenylethyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18310753 |
| Molecular Formula | C25H39N7O7S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | 4-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-[(1-carboxy-2-phenylethyl)amino]-5-oxopentanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H39N7O7S/c1-40-13-11-16(26)21(35)30-17(8-5-12-29-25(27)28)22(36)31-18(9-10-20(33)34)23(37)32-19(24(38)39)14-15-6-3-2-4-7-15/h2-4,6-7,16-19H,5,8-14,26H2,1H3,(H,30,35)(H,31,36)(H,32,37)(H,33,34)(H,38,39)(H4,27,28,29) |
| InChIKey | RJEGFLAIHXWRBE-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|