C23H37N7O5S2 — CID 18259913
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18259913) has the molecular formula C23H37N7O5S2 and a molecular weight of 555.73 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18259913 |
| Molecular Formula | C23H37N7O5S2 |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CSCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CS)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H37N7O5S2/c1-37-11-9-16(20(32)29-17(22(34)35)8-5-10-27-23(25)26)28-21(33)18(30-19(31)15(24)13-36)12-14-6-3-2-4-7-14/h2-4,6-7,15-18,36H,5,8-13,24H2,1H3,(H,28,33)(H,29,32)(H,30,31)(H,34,35)(H4,25,26,27) |
| InChIKey | BMPRNTUJILQBJR-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|