C22H35N7O5S — CID 18489720
2-[[2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18489720) has the molecular formula C22H35N7O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18489720 |
| Molecular Formula | C22H35N7O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CSCCC(NC(=O)CN)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H35N7O5S/c1-35-11-9-15(27-18(30)13-23)19(31)29-17(12-14-6-3-2-4-7-14)20(32)28-16(21(33)34)8-5-10-26-22(24)25/h2-4,6-7,15-17H,5,8-13,23H2,1H3,(H,27,30)(H,28,32)(H,29,31)(H,33,34)(H4,24,25,26) |
| InChIKey | VUEDMHJDUUBAOY-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|