C19H38N8O5S — CID 18489490
6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid (PubChem CID 18489490) has the molecular formula C19H38N8O5S and a molecular weight of 490.63 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18489490 |
| Molecular Formula | C19H38N8O5S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
| SMILES | CSCCC(NC(=O)CN)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H38N8O5S/c1-33-10-7-13(25-15(28)11-21)17(30)26-12(6-4-9-24-19(22)23)16(29)27-14(18(31)32)5-2-3-8-20/h12-14H,2-11,20-21H2,1H3,(H,25,28)(H,26,30)(H,27,29)(H,31,32)(H4,22,23,24) |
| InChIKey | ZELPGFYTBDHGJL-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|