C14H29CuN7O4+2 — CID 10002390
copper 6-amino-2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid (PubChem CID 10002390) has the molecular formula C14H29CuN7O4+2 and a molecular weight of 422.98 g/mol. Its IUPAC name is copper 6-amino-2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid.
| Compound Name | copper 6-amino-2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 10002390 |
| Molecular Formula | C14H29CuN7O4+2 |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | copper 6-amino-2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCCN=C(N)N)NC(=O)CN)C(=O)O.[Cu+2] |
| InChI | InChI=1S/C14H29N7O4.Cu/c15-6-2-1-4-10(13(24)25)21-12(23)9(20-11(22)8-16)5-3-7-19-14(17)18;/h9-10H,1-8,15-16H2,(H,20,22)(H,21,23)(H,24,25)(H4,17,18,19);/q;+2 |
| InChIKey | AIEOQWDXGWOTNC-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 211.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|