C19H38N8O5 — CID 18489110
2-[[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid (PubChem CID 18489110) has the molecular formula C19H38N8O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18489110 |
| Molecular Formula | C19H38N8O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCCN)NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C19H38N8O5/c1-11(2)15(18(31)32)27-17(30)13(7-5-9-24-19(22)23)26-16(29)12(6-3-4-8-20)25-14(28)10-21/h11-13,15H,3-10,20-21H2,1-2H3,(H,25,28)(H,26,29)(H,27,30)(H,31,32)(H4,22,23,24) |
| InChIKey | KYNKORWFXZYZHH-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|