C16H31N7O5 — CID 18484791
2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid (PubChem CID 18484791) has the molecular formula C16H31N7O5 and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18484791 |
| Molecular Formula | C16H31N7O5 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(NC(=O)CN)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C16H31N7O5/c1-8(2)12(15(27)28)23-14(26)10(5-4-6-20-16(18)19)22-13(25)9(3)21-11(24)7-17/h8-10,12H,4-7,17H2,1-3H3,(H,21,24)(H,22,25)(H,23,26)(H,27,28)(H4,18,19,20) |
| InChIKey | FENMJHJFGRJKEJ-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|