C20H39N11O6 — CID 175723724
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid (PubChem CID 175723724) has the molecular formula C20H39N11O6 and a molecular weight of 529.60 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175723724 |
| Molecular Formula | C20H39N11O6 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C20H39N11O6/c1-10(28-16(34)12(30-14(32)9-21)5-3-7-26-19(22)23)15(33)31-13(6-4-8-27-20(24)25)17(35)29-11(2)18(36)37/h10-13H,3-9,21H2,1-2H3,(H,28,34)(H,29,35)(H,30,32)(H,31,33)(H,36,37)(H4,22,23,26)(H4,24,25,27)/t10-,11-,12-,13-/m0/s1 |
| InChIKey | GYBWABAKPQAMIL-CYDGBPFRSA-N |
| XLogP | -4.88 |
| TPSA | 308.52 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | -4.88 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|